C17H24N4 — CID 58611253
4-N-[3-(4-amino-3-methylanilino)propyl]-2-methylbenzene-1,4-diamine (PubChem CID 58611253) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-[3-(4-amino-3-methylanilino)propyl]-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[3-(4-amino-3-methylanilino)propyl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 58611253 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-[3-(4-amino-3-methylanilino)propyl]-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(NCCCNc2ccc(N)c(C)c2)ccc1N |
| InChI | InChI=1S/C17H24N4/c1-12-10-14(4-6-16(12)18)20-8-3-9-21-15-5-7-17(19)13(2)11-15/h4-7,10-11,20-21H,3,8-9,18-19H2,1-2H3 |
| InChIKey | JDSACYOZJRGVPW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|