C10H15N3O2 — CID 83201975
2-(4-amino-3-methylanilino)ethyl carbamate (PubChem CID 83201975) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(4-amino-3-methylanilino)ethyl carbamate.
| Compound Name | 2-(4-amino-3-methylanilino)ethyl carbamate |
|---|---|
| PubChem CID | 83201975 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(4-amino-3-methylanilino)ethyl carbamate |
| SMILES | Cc1cc(NCCOC(N)=O)ccc1N |
| InChI | InChI=1S/C10H15N3O2/c1-7-6-8(2-3-9(7)11)13-4-5-15-10(12)14/h2-3,6,13H,4-5,11H2,1H3,(H2,12,14) |
| InChIKey | IQWHWNGAFGQLOJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|