C9H13N3O3 — CID 83205251
2-[(2-methoxy-4-pyridinyl)amino]ethyl carbamate (PubChem CID 83205251) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-[(2-methoxy-4-pyridinyl)amino]ethyl carbamate.
| Compound Name | 2-[(2-methoxy-4-pyridinyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83205251 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[(2-methoxy-4-pyridinyl)amino]ethyl carbamate |
| SMILES | COc1cc(NCCOC(N)=O)ccn1 |
| InChI | InChI=1S/C9H13N3O3/c1-14-8-6-7(2-3-12-8)11-4-5-15-9(10)13/h2-3,6H,4-5H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | IQAYIIHEQUZTQD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|