C11H19N3O — CID 107323427
N'-(2-methoxy-4-pyridinyl)pentane-1,5-diamine (PubChem CID 107323427) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N'-(2-methoxy-4-pyridinyl)pentane-1,5-diamine.
| Compound Name | N'-(2-methoxy-4-pyridinyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 107323427 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N'-(2-methoxy-4-pyridinyl)pentane-1,5-diamine |
| SMILES | COc1cc(NCCCCCN)ccn1 |
| InChI | InChI=1S/C11H19N3O/c1-15-11-9-10(5-8-14-11)13-7-4-2-3-6-12/h5,8-9H,2-4,6-7,12H2,1H3,(H,13,14) |
| InChIKey | KPVNHZGXEGPEQX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|