C11H19N3 — CID 107323471
N'-(4-methyl-2-pyridinyl)pentane-1,5-diamine (PubChem CID 107323471) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N'-(4-methyl-2-pyridinyl)pentane-1,5-diamine.
| Compound Name | N'-(4-methyl-2-pyridinyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 107323471 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N'-(4-methyl-2-pyridinyl)pentane-1,5-diamine |
| SMILES | Cc1ccnc(NCCCCCN)c1 |
| InChI | InChI=1S/C11H19N3/c1-10-5-8-14-11(9-10)13-7-4-2-3-6-12/h5,8-9H,2-4,6-7,12H2,1H3,(H,13,14) |
| InChIKey | OPAMIPCUNLNPJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|