C17H32IN3 — CID 160709638
triethyl-[5-[(4-methyl-2-pyridinyl)amino]pentyl]azanium iodide (PubChem CID 160709638) has the molecular formula C17H32IN3 and a molecular weight of 405.37 g/mol. Its IUPAC name is triethyl-[5-[(4-methyl-2-pyridinyl)amino]pentyl]azanium iodide.
| Compound Name | triethyl-[5-[(4-methyl-2-pyridinyl)amino]pentyl]azanium iodide |
|---|---|
| PubChem CID | 160709638 |
| Molecular Formula | C17H32IN3 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | triethyl-[5-[(4-methyl-2-pyridinyl)amino]pentyl]azanium iodide |
| SMILES | CC[N+](CC)(CC)CCCCCNc1cc(C)ccn1.[I-] |
| InChI | InChI=1S/C17H32N3.HI/c1-5-20(6-2,7-3)14-10-8-9-12-18-17-15-16(4)11-13-19-17;/h11,13,15H,5-10,12,14H2,1-4H3,(H,18,19);1H/q+1;/p-1 |
| InChIKey | CZHFDSKYAJMJRY-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|