C13H18F2N3O2+ — CID 152897798
4,4-difluoropent-2-enoyl-[2-[(2-methoxy-4-pyridinyl)amino]ethyl]azanium (PubChem CID 152897798) has the molecular formula C13H18F2N3O2+ and a molecular weight of 286.30 g/mol. Its IUPAC name is 4,4-difluoropent-2-enoyl-[2-[(2-methoxy-4-pyridinyl)amino]ethyl]azanium.
| Compound Name | 4,4-difluoropent-2-enoyl-[2-[(2-methoxy-4-pyridinyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 152897798 |
| Molecular Formula | C13H18F2N3O2+ |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4,4-difluoropent-2-enoyl-[2-[(2-methoxy-4-pyridinyl)amino]ethyl]azanium |
| SMILES | COc1cc(NCC[NH2+]C(=O)C=CC(C)(F)F)ccn1 |
| InChI | InChI=1S/C13H17F2N3O2/c1-13(14,15)5-3-11(19)17-8-7-16-10-4-6-18-12(9-10)20-2/h3-6,9H,7-8H2,1-2H3,(H,16,18)(H,17,19)/p+1 |
| InChIKey | UESQHGVVIKYBST-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|