C15H20F2N2O2 — CID 158639346
(E)-7,7-difluoro-1-[(6-methoxy-4-methyl-2-pyridinyl)amino]oct-5-en-4-one (PubChem CID 158639346) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is (E)-7,7-difluoro-1-[(6-methoxy-4-methyl-2-pyridinyl)amino]oct-5-en-4-one.
| Compound Name | (E)-7,7-difluoro-1-[(6-methoxy-4-methyl-2-pyridinyl)amino]oct-5-en-4-one |
|---|---|
| PubChem CID | 158639346 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (E)-7,7-difluoro-1-[(6-methoxy-4-methyl-2-pyridinyl)amino]oct-5-en-4-one |
| SMILES | COc1cc(C)cc(NCCCC(=O)/C=C/C(C)(F)F)n1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-11-9-13(19-14(10-11)21-3)18-8-4-5-12(20)6-7-15(2,16)17/h6-7,9-10H,4-5,8H2,1-3H3,(H,18,19)/b7-6+ |
| InChIKey | IAEGZVZMKXICMI-VOTSOKGWSA-N |
| XLogP | 3.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|