C9H12F3N3OS — CID 106431054
6-methoxy-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine (PubChem CID 106431054) has the molecular formula C9H12F3N3OS and a molecular weight of 267.28 g/mol. Its IUPAC name is 6-methoxy-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-methoxy-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106431054 |
| Molecular Formula | C9H12F3N3OS |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 6-methoxy-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
| SMILES | COc1cc(NCCSC(F)(F)F)nc(C)n1 |
| InChI | InChI=1S/C9H12F3N3OS/c1-6-14-7(5-8(15-6)16-2)13-3-4-17-9(10,11)12/h5H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | WYCSNOLSSZJOMM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|