C12H19F3N4S — CID 106433946
6-N-ethyl-2-propan-2-yl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine (PubChem CID 106433946) has the molecular formula C12H19F3N4S and a molecular weight of 308.37 g/mol. Its IUPAC name is 6-N-ethyl-2-propan-2-yl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-2-propan-2-yl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106433946 |
| Molecular Formula | C12H19F3N4S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 6-N-ethyl-2-propan-2-yl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCSC(F)(F)F)nc(C(C)C)n1 |
| InChI | InChI=1S/C12H19F3N4S/c1-4-16-9-7-10(19-11(18-9)8(2)3)17-5-6-20-12(13,14)15/h7-8H,4-6H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | CYFHANNJRXYRKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|