C9H13F3N4S2 — CID 106433976
6-N-methyl-2-methylsulfanyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine (PubChem CID 106433976) has the molecular formula C9H13F3N4S2 and a molecular weight of 298.36 g/mol. Its IUPAC name is 6-N-methyl-2-methylsulfanyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-2-methylsulfanyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106433976 |
| Molecular Formula | C9H13F3N4S2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-N-methyl-2-methylsulfanyl-4-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4,6-diamine |
| SMILES | CNc1cc(NCCSC(F)(F)F)nc(SC)n1 |
| InChI | InChI=1S/C9H13F3N4S2/c1-13-6-5-7(16-8(15-6)17-2)14-3-4-18-9(10,11)12/h5H,3-4H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | OAPGYOZGSCJCHJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|