C11H20N4S2 — CID 80838992
2-methylsulfanyl-4-N-(2-methylsulfanylethyl)-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80838992) has the molecular formula C11H20N4S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-methylsulfanyl-4-N-(2-methylsulfanylethyl)-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 2-methylsulfanyl-4-N-(2-methylsulfanylethyl)-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80838992 |
| Molecular Formula | C11H20N4S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-methylsulfanyl-4-N-(2-methylsulfanylethyl)-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(NCCSC)nc(SC)n1 |
| InChI | InChI=1S/C11H20N4S2/c1-4-5-12-9-8-10(13-6-7-16-2)15-11(14-9)17-3/h8H,4-7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | QDVKAYKGQGBKDX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|