C12H22N4S2 — CID 113488426
6-N-ethyl-2-methylsulfanyl-4-N-(4-methylsulfanylbutyl)pyrimidine-4,6-diamine (PubChem CID 113488426) has the molecular formula C12H22N4S2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 6-N-ethyl-2-methylsulfanyl-4-N-(4-methylsulfanylbutyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-2-methylsulfanyl-4-N-(4-methylsulfanylbutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 113488426 |
| Molecular Formula | C12H22N4S2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 6-N-ethyl-2-methylsulfanyl-4-N-(4-methylsulfanylbutyl)pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCCCSC)nc(SC)n1 |
| InChI | InChI=1S/C12H22N4S2/c1-4-13-10-9-11(16-12(15-10)18-3)14-7-5-6-8-17-2/h9H,4-8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | GHFKJWIADJFTLU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|