C12H22N4S — CID 80935445
6-N,2-diethyl-4-N-(3-methylsulfanylpropyl)pyrimidine-4,6-diamine (PubChem CID 80935445) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 6-N,2-diethyl-4-N-(3-methylsulfanylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,2-diethyl-4-N-(3-methylsulfanylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80935445 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 6-N,2-diethyl-4-N-(3-methylsulfanylpropyl)pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCCSC)nc(CC)n1 |
| InChI | InChI=1S/C12H22N4S/c1-4-10-15-11(13-5-2)9-12(16-10)14-7-6-8-17-3/h9H,4-8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | JEGJTIMXADEDPX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|