C11H20N4OS — CID 113493058
1-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]butan-2-ol (PubChem CID 113493058) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]butan-2-ol.
| Compound Name | 1-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 113493058 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]butan-2-ol |
| SMILES | CCNc1cc(NCC(O)CC)nc(SC)n1 |
| InChI | InChI=1S/C11H20N4OS/c1-4-8(16)7-13-10-6-9(12-5-2)14-11(15-10)17-3/h6,8,16H,4-5,7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | MAFHOYHALILOOS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |