C9H16N4OS — CID 80765964
2-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]ethanol (PubChem CID 80765964) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 80765964 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]ethanol |
| SMILES | CCNc1cc(NCCO)nc(SC)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-10-7-6-8(11-4-5-14)13-9(12-7)15-2/h6,14H,3-5H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | YHRHCJXNJUPZAP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |