C12H22N4OS — CID 80780195
2-[[2-methylsulfanyl-6-(propylamino)pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 80780195) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[[2-methylsulfanyl-6-(propylamino)pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 2-[[2-methylsulfanyl-6-(propylamino)pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 80780195 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[[2-methylsulfanyl-6-(propylamino)pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CCCNc1cc(NC(CC)CO)nc(SC)n1 |
| InChI | InChI=1S/C12H22N4OS/c1-4-6-13-10-7-11(14-9(5-2)8-17)16-12(15-10)18-3/h7,9,17H,4-6,8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | XJVZIGPAVMQSCZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |