C13H25N5S — CID 80817211
4-N-[4-(dimethylamino)butyl]-6-N-ethyl-2-methylsulfanylpyrimidine-4,6-diamine (PubChem CID 80817211) has the molecular formula C13H25N5S and a molecular weight of 283.44 g/mol. Its IUPAC name is 4-N-[4-(dimethylamino)butyl]-6-N-ethyl-2-methylsulfanylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[4-(dimethylamino)butyl]-6-N-ethyl-2-methylsulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80817211 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-N-[4-(dimethylamino)butyl]-6-N-ethyl-2-methylsulfanylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCCCN(C)C)nc(SC)n1 |
| InChI | InChI=1S/C13H25N5S/c1-5-14-11-10-12(17-13(16-11)19-4)15-8-6-7-9-18(2)3/h10H,5-9H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | XSPSXAROGBOEHL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|