C10H20N6S — CID 80919066
N'-ethyl-N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-methylethane-1,2-diamine (PubChem CID 80919066) has the molecular formula C10H20N6S and a molecular weight of 256.38 g/mol. Its IUPAC name is N'-ethyl-N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 80919066 |
| Molecular Formula | C10H20N6S |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | N'-ethyl-N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1cc(NN)nc(SC)n1 |
| InChI | InChI=1S/C10H20N6S/c1-4-16(2)6-5-12-8-7-9(15-11)14-10(13-8)17-3/h7H,4-6,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | LOUHOTFRECJNFD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|