C10H14N6S2 — CID 80910991
6-hydrazinyl-2-methylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 80910991) has the molecular formula C10H14N6S2 and a molecular weight of 282.40 g/mol. Its IUPAC name is 6-hydrazinyl-2-methylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-methylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80910991 |
| Molecular Formula | C10H14N6S2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6-hydrazinyl-2-methylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | CSc1nc(NN)cc(NCCc2cscn2)n1 |
| InChI | InChI=1S/C10H14N6S2/c1-17-10-14-8(4-9(15-10)16-11)12-3-2-7-5-18-6-13-7/h4-6H,2-3,11H2,1H3,(H2,12,14,15,16) |
| InChIKey | KKEPEEFZJRXXAC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|