C11H22N6OS — CID 80919403
N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 80919403) has the molecular formula C11H22N6OS and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 80919403 |
| Molecular Formula | C11H22N6OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNc1cc(NN)nc(SC)n1 |
| InChI | InChI=1S/C11H22N6OS/c1-17(6-7-18-2)5-4-13-9-8-10(16-12)15-11(14-9)19-3/h8H,4-7,12H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | BFHIECNOXCVIBY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|