C11H19F3N6O — CID 106775656
N-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 106775656) has the molecular formula C11H19F3N6O and a molecular weight of 308.31 g/mol. Its IUPAC name is N-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 106775656 |
| Molecular Formula | C11H19F3N6O |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNc1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H19F3N6O/c1-20(5-6-21-2)4-3-16-8-7-9(19-15)18-10(17-8)11(12,13)14/h7H,3-6,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | KOYBQMAEZKXUQW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|