C10H16F3N5O — CID 106775663
6-hydrazinyl-N-(3-methoxypropyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775663) has the molecular formula C10H16F3N5O and a molecular weight of 279.27 g/mol. Its IUPAC name is 6-hydrazinyl-N-(3-methoxypropyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(3-methoxypropyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106775663 |
| Molecular Formula | C10H16F3N5O |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 6-hydrazinyl-N-(3-methoxypropyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | COCCCN(C)c1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N5O/c1-18(4-3-5-19-2)8-6-7(17-14)15-9(16-8)10(11,12)13/h6H,3-5,14H2,1-2H3,(H,15,16,17) |
| InChIKey | JFRIOENAIXTZNW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|