C11H19F3N6 — CID 106775714
N'-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 106775714) has the molecular formula C11H19F3N6 and a molecular weight of 292.31 g/mol. Its IUPAC name is N'-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106775714 |
| Molecular Formula | C11H19F3N6 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N'-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)c1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H19F3N6/c1-19(2)5-4-6-20(3)9-7-8(18-15)16-10(17-9)11(12,13)14/h7H,4-6,15H2,1-3H3,(H,16,17,18) |
| InChIKey | UKWQQGPXPDYCJT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|