C11H15F3N6O — CID 106775558
N-cyclopropyl-2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]acetamide (PubChem CID 106775558) has the molecular formula C11H15F3N6O and a molecular weight of 304.28 g/mol. Its IUPAC name is N-cyclopropyl-2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]acetamide |
|---|---|
| PubChem CID | 106775558 |
| Molecular Formula | C11H15F3N6O |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-cyclopropyl-2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NC1CC1)c1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N6O/c1-20(5-9(21)16-6-2-3-6)8-4-7(19-15)17-10(18-8)11(12,13)14/h4,6H,2-3,5,15H2,1H3,(H,16,21)(H,17,18,19) |
| InChIKey | NTBSXUSQRXMSRB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|