C9H12F3N5O — CID 106770720
2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylacetamide (PubChem CID 106770720) has the molecular formula C9H12F3N5O and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylacetamide.
| Compound Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 106770720 |
| Molecular Formula | C9H12F3N5O |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)c1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N5O/c1-14-7(18)4-17(2)6-3-5(13)15-8(16-6)9(10,11)12/h3H,4H2,1-2H3,(H,14,18)(H2,13,15,16) |
| InChIKey | IGCDSMJZFXBKSM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |