C9H11F3N6O2 — CID 106771829
2-[(2-amino-2-oxoethyl)-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide (PubChem CID 106771829) has the molecular formula C9H11F3N6O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 106771829 |
| Molecular Formula | C9H11F3N6O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)c1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N6O2/c10-9(11,12)8-16-4(13)1-7(17-8)18(2-5(14)19)3-6(15)20/h1H,2-3H2,(H2,14,19)(H2,15,20)(H2,13,16,17) |
| InChIKey | HMLIGSUNMXRXHZ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |