C12H18F3N5O — CID 106771446
2-[butyl-[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide (PubChem CID 106771446) has the molecular formula C12H18F3N5O and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[butyl-[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide.
| Compound Name | 2-[butyl-[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 106771446 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-[butyl-[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)c1cc(NC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N5O/c1-3-4-5-20(7-8(16)21)10-6-9(17-2)18-11(19-10)12(13,14)15/h6H,3-5,7H2,1-2H3,(H2,16,21)(H,17,18,19) |
| InChIKey | QVWKLMHDBBWWOB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |