C14H23F3N4 — CID 106770292
4-N,4-N,6-N-tripropyl-2-(trifluoromethyl)pyrimidine-4,6-diamine (PubChem CID 106770292) has the molecular formula C14H23F3N4 and a molecular weight of 304.36 g/mol. Its IUPAC name is 4-N,4-N,6-N-tripropyl-2-(trifluoromethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N,6-N-tripropyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106770292 |
| Molecular Formula | C14H23F3N4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-N,4-N,6-N-tripropyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(N(CCC)CCC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H23F3N4/c1-4-7-18-11-10-12(21(8-5-2)9-6-3)20-13(19-11)14(15,16)17/h10H,4-9H2,1-3H3,(H,18,19,20) |
| InChIKey | CPGWTNGDLLQCFH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |