C13H21F3N4 — CID 106770662
6-N-ethyl-4-N-methyl-4-N-pentyl-2-(trifluoromethyl)pyrimidine-4,6-diamine (PubChem CID 106770662) has the molecular formula C13H21F3N4 and a molecular weight of 290.33 g/mol. Its IUPAC name is 6-N-ethyl-4-N-methyl-4-N-pentyl-2-(trifluoromethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-methyl-4-N-pentyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106770662 |
| Molecular Formula | C13H21F3N4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 6-N-ethyl-4-N-methyl-4-N-pentyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
| SMILES | CCCCCN(C)c1cc(NCC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H21F3N4/c1-4-6-7-8-20(3)11-9-10(17-5-2)18-12(19-11)13(14,15)16/h9H,4-8H2,1-3H3,(H,17,18,19) |
| InChIKey | PWOVJMFBAMFSCA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|