C12H19F3N4O — CID 106772441
1-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropan-2-ol (PubChem CID 106772441) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106772441 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-2-methylpropan-2-ol |
| SMILES | CCNc1cc(N(C)CC(C)(C)O)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H19F3N4O/c1-5-16-8-6-9(19(4)7-11(2,3)20)18-10(17-8)12(13,14)15/h6,20H,5,7H2,1-4H3,(H,16,17,18) |
| InChIKey | FBEDSIIQRNAMRD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |