C13H20F3N3O — CID 102718868
1-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-2-methylpropan-2-ol (PubChem CID 102718868) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is 1-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 102718868 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-2-methylpropan-2-ol |
| SMILES | CCNc1cc(C(F)(F)F)cc(N(C)CC(C)(C)O)n1 |
| InChI | InChI=1S/C13H20F3N3O/c1-5-17-10-6-9(13(14,15)16)7-11(18-10)19(4)8-12(2,3)20/h6-7,20H,5,8H2,1-4H3,(H,17,18) |
| InChIKey | BUGZSILCOPMFCK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |