C12H18F3N3 — CID 102717307
6-N-butyl-2-N-ethyl-4-(trifluoromethyl)pyridine-2,6-diamine (PubChem CID 102717307) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 6-N-butyl-2-N-ethyl-4-(trifluoromethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-butyl-2-N-ethyl-4-(trifluoromethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102717307 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-N-butyl-2-N-ethyl-4-(trifluoromethyl)pyridine-2,6-diamine |
| SMILES | CCCCNc1cc(C(F)(F)F)cc(NCC)n1 |
| InChI | InChI=1S/C12H18F3N3/c1-3-5-6-17-11-8-9(12(13,14)15)7-10(18-11)16-4-2/h7-8H,3-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | ZRZCUWJHXVOXKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|