C12H17F3N2O — CID 102719643
N-ethyl-6-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102719643) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is N-ethyl-6-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-ethyl-6-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102719643 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-ethyl-6-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCNc1cc(C(F)(F)F)cc(OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H17F3N2O/c1-5-16-9-6-8(12(13,14)15)7-10(17-9)18-11(2,3)4/h6-7H,5H2,1-4H3,(H,16,17) |
| InChIKey | PYQAUAADJYJYKJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |