C14H12F3IN2O — CID 102719878
N-ethyl-6-(4-iodophenoxy)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102719878) has the molecular formula C14H12F3IN2O and a molecular weight of 408.16 g/mol. Its IUPAC name is N-ethyl-6-(4-iodophenoxy)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-ethyl-6-(4-iodophenoxy)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102719878 |
| Molecular Formula | C14H12F3IN2O |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | N-ethyl-6-(4-iodophenoxy)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCNc1cc(C(F)(F)F)cc(Oc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C14H12F3IN2O/c1-2-19-12-7-9(14(15,16)17)8-13(20-12)21-11-5-3-10(18)4-6-11/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | AMZFWAIXEZEKFY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|