C12H9F4N3O — CID 102721265
[6-(4-fluorophenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721265) has the molecular formula C12H9F4N3O and a molecular weight of 287.22 g/mol. Its IUPAC name is [6-(4-fluorophenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(4-fluorophenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721265 |
| Molecular Formula | C12H9F4N3O |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | [6-(4-fluorophenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)cc(Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H9F4N3O/c13-8-1-3-9(4-2-8)20-11-6-7(12(14,15)16)5-10(18-11)19-17/h1-6H,17H2,(H,18,19) |
| InChIKey | QHTBOVCOYMSIJQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|