C13H12F3N3O — CID 102721263
[6-(3-methylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721263) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is [6-(3-methylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(3-methylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721263 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [6-(3-methylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | Cc1cccc(Oc2cc(C(F)(F)F)cc(NN)n2)c1 |
| InChI | InChI=1S/C13H12F3N3O/c1-8-3-2-4-10(5-8)20-12-7-9(13(14,15)16)6-11(18-12)19-17/h2-7H,17H2,1H3,(H,18,19) |
| InChIKey | IRMWZBCQVYDQEK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|