About [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine
[6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721260) has the molecular formula C14H14F3N3O
and a molecular weight of 297.28 g/mol. Its IUPAC name is [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| PubChem CID | 102721260 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | Cc1ccc(C)c(Oc2cc(C(F)(F)F)cc(NN)n2)c1 |
| InChI | InChI=1S/C14H14F3N3O/c1-8-3-4-9(2)11(5-8)21-13-7-10(14(15,16)17)6-12(19-13)20-18/h3-7H,18H2,1-2H3,(H,19,20) |
| InChIKey | HDASRQLMJMLTJT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine?
The IUPAC name of [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (CID 102721260) is [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine?
The canonical SMILES for [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine is Cc1ccc(C)c(Oc2cc(C(F)(F)F)cc(NN)n2)c1.
What is the InChIKey of [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine?
The InChIKey is HDASRQLMJMLTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3O/c1-8-3-4-9(2)11(5-8)21-13-7-10(14(15,16)17)6-12(19-13)20-18/h3-7H,18H2,1-2H3,(H,19,20).
What are the key properties of [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine?
[6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine has a molecular weight of 297.28 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,5-dimethylphenoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 102721260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).