C13H12F3N3O — CID 106774078
6-(2,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106774078) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 6-(2,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(2,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106774078 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 6-(2,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(C)c(Oc2cc(N)nc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C13H12F3N3O/c1-7-3-4-8(2)9(5-7)20-11-6-10(17)18-12(19-11)13(14,15)16/h3-6H,1-2H3,(H2,17,18,19) |
| InChIKey | VAJXSICCLXGFGZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |