C12H9F4N3O — CID 107171778
6-(3-fluoro-4-methylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 107171778) has the molecular formula C12H9F4N3O and a molecular weight of 287.22 g/mol. Its IUPAC name is 6-(3-fluoro-4-methylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(3-fluoro-4-methylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107171778 |
| Molecular Formula | C12H9F4N3O |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-(3-fluoro-4-methylphenoxy)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(Oc2cc(N)nc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C12H9F4N3O/c1-6-2-3-7(4-8(6)13)20-10-5-9(17)18-11(19-10)12(14,15)16/h2-5H,1H3,(H2,17,18,19) |
| InChIKey | BJXOCLCNEVFGKG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |