C12H11F3N4OS — CID 80910588
[2-methylsulfanyl-6-[4-(trifluoromethyl)phenoxy]pyrimidin-4-yl]hydrazine (PubChem CID 80910588) has the molecular formula C12H11F3N4OS and a molecular weight of 316.31 g/mol. Its IUPAC name is [2-methylsulfanyl-6-[4-(trifluoromethyl)phenoxy]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methylsulfanyl-6-[4-(trifluoromethyl)phenoxy]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80910588 |
| Molecular Formula | C12H11F3N4OS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [2-methylsulfanyl-6-[4-(trifluoromethyl)phenoxy]pyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(Oc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C12H11F3N4OS/c1-21-11-17-9(19-16)6-10(18-11)20-8-4-2-7(3-5-8)12(13,14)15/h2-6H,16H2,1H3,(H,17,18,19) |
| InChIKey | LAGZBFSQTLPYPU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|