C6H10N4OS — CID 80909923
(6-methoxy-2-methylsulfanylpyrimidin-4-yl)hydrazine (PubChem CID 80909923) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is (6-methoxy-2-methylsulfanylpyrimidin-4-yl)hydrazine.
| Compound Name | (6-methoxy-2-methylsulfanylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 80909923 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | (6-methoxy-2-methylsulfanylpyrimidin-4-yl)hydrazine |
| SMILES | COc1cc(NN)nc(SC)n1 |
| InChI | InChI=1S/C6H10N4OS/c1-11-5-3-4(10-7)8-6(9-5)12-2/h3H,7H2,1-2H3,(H,8,9,10) |
| InChIKey | OFDKPCOLSQJSLF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|