C8H10F4N4OS — CID 80913891
[2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine (PubChem CID 80913891) has the molecular formula C8H10F4N4OS and a molecular weight of 286.25 g/mol. Its IUPAC name is [2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80913891 |
| Molecular Formula | C8H10F4N4OS |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | [2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H10F4N4OS/c1-18-7-14-4(16-13)2-5(15-7)17-3-8(11,12)6(9)10/h2,6H,3,13H2,1H3,(H,14,15,16) |
| InChIKey | JNMZFALRUGMBMJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|