C12H12Br2N4O2S — CID 80924928
[6-(2,5-dibromo-4-methoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80924928) has the molecular formula C12H12Br2N4O2S and a molecular weight of 436.13 g/mol. Its IUPAC name is [6-(2,5-dibromo-4-methoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,5-dibromo-4-methoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80924928 |
| Molecular Formula | C12H12Br2N4O2S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | [6-(2,5-dibromo-4-methoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
| SMILES | COc1cc(Br)c(Oc2cc(NN)nc(SC)n2)cc1Br |
| InChI | InChI=1S/C12H12Br2N4O2S/c1-19-8-3-7(14)9(4-6(8)13)20-11-5-10(18-15)16-12(17-11)21-2/h3-5H,15H2,1-2H3,(H,16,17,18) |
| InChIKey | MHMRXCUOXCWTNV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|