C14H18N4OS — CID 80916728
[2-methylsulfanyl-6-(2,3,6-trimethylphenoxy)pyrimidin-4-yl]hydrazine (PubChem CID 80916728) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is [2-methylsulfanyl-6-(2,3,6-trimethylphenoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methylsulfanyl-6-(2,3,6-trimethylphenoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80916728 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [2-methylsulfanyl-6-(2,3,6-trimethylphenoxy)pyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(Oc2c(C)ccc(C)c2C)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-8-5-6-9(2)13(10(8)3)19-12-7-11(18-15)16-14(17-12)20-4/h5-7H,15H2,1-4H3,(H,16,17,18) |
| InChIKey | RAAITNBVSZZDGE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|