C11H10ClFN4OS — CID 80921341
[6-(3-chloro-4-fluorophenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80921341) has the molecular formula C11H10ClFN4OS and a molecular weight of 300.75 g/mol. Its IUPAC name is [6-(3-chloro-4-fluorophenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3-chloro-4-fluorophenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80921341 |
| Molecular Formula | C11H10ClFN4OS |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | [6-(3-chloro-4-fluorophenoxy)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(Oc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H10ClFN4OS/c1-19-11-15-9(17-14)5-10(16-11)18-6-2-3-8(13)7(12)4-6/h2-5H,14H2,1H3,(H,15,16,17) |
| InChIKey | PPTZUZGTCMKJMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|