C12H11ClFN3O — CID 80876593
6-(3-chloro-4-fluorophenoxy)-N,2-dimethylpyrimidin-4-amine (PubChem CID 80876593) has the molecular formula C12H11ClFN3O and a molecular weight of 267.69 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenoxy)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-(3-chloro-4-fluorophenoxy)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80876593 |
| Molecular Formula | C12H11ClFN3O |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-(3-chloro-4-fluorophenoxy)-N,2-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(Oc2ccc(F)c(Cl)c2)nc(C)n1 |
| InChI | InChI=1S/C12H11ClFN3O/c1-7-16-11(15-2)6-12(17-7)18-8-3-4-10(14)9(13)5-8/h3-6H,1-2H3,(H,15,16,17) |
| InChIKey | RVQJAFDHBWCBAE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |