C13H13N3O3 — CID 80882204
6-(1,3-benzodioxol-5-yloxy)-N,2-dimethylpyrimidin-4-amine (PubChem CID 80882204) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yloxy)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-(1,3-benzodioxol-5-yloxy)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80882204 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yloxy)-N,2-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(Oc2ccc3c(c2)OCO3)nc(C)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-8-15-12(14-2)6-13(16-8)19-9-3-4-10-11(5-9)18-7-17-10/h3-6H,7H2,1-2H3,(H,14,15,16) |
| InChIKey | MCNIOTMAIIOUGL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |