C11H8ClN3O3 — CID 47151279
4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-2-amine (PubChem CID 47151279) has the molecular formula C11H8ClN3O3 and a molecular weight of 265.66 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-2-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-2-amine |
|---|---|
| PubChem CID | 47151279 |
| Molecular Formula | C11H8ClN3O3 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(Oc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C11H8ClN3O3/c12-9-4-10(15-11(13)14-9)18-6-1-2-7-8(3-6)17-5-16-7/h1-4H,5H2,(H2,13,14,15) |
| InChIKey | NOXCBLQUXCZYRJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |