C12H6Cl3NO3 — CID 113222181
2-(1,3-benzodioxol-5-yloxy)-3,5,6-trichloropyridine (PubChem CID 113222181) has the molecular formula C12H6Cl3NO3 and a molecular weight of 318.54 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-3,5,6-trichloropyridine.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-3,5,6-trichloropyridine |
|---|---|
| PubChem CID | 113222181 |
| Molecular Formula | C12H6Cl3NO3 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-3,5,6-trichloropyridine |
| SMILES | Clc1cc(Cl)c(Oc2ccc3c(c2)OCO3)nc1Cl |
| InChI | InChI=1S/C12H6Cl3NO3/c13-7-4-8(14)12(16-11(7)15)19-6-1-2-9-10(3-6)18-5-17-9/h1-4H,5H2 |
| InChIKey | YSGVPBQZKHYDLY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|